C25H43ClN2O — CID 69280200
1-[4-methoxy-2-(1,2,2,3-tetramethylcyclohexyl)phenyl]-4-(2-methylpropyl)piperazine;hydrochloride (PubChem CID 69280200) has the molecular formula C25H43ClN2O and a molecular weight of 423.09 g/mol. Its IUPAC name is 1-[4-methoxy-2-(1,2,2,3-tetramethylcyclohexyl)phenyl]-4-(2-methylpropyl)piperazine;hydrochloride.
| Compound Name | 1-[4-methoxy-2-(1,2,2,3-tetramethylcyclohexyl)phenyl]-4-(2-methylpropyl)piperazine;hydrochloride |
|---|---|
| PubChem CID | 69280200 |
| Molecular Formula | C25H43ClN2O |
| Molecular Weight | 423.09 g/mol |
| Exact Mass | 422.31 |
| IUPAC Name | 1-[4-methoxy-2-(1,2,2,3-tetramethylcyclohexyl)phenyl]-4-(2-methylpropyl)piperazine;hydrochloride |
| SMILES | COc1ccc(N2CCN(CC(C)C)CC2)c(C2(C)CCCC(C)C2(C)C)c1.Cl |
| InChI | InChI=1S/C25H42N2O.ClH/c1-19(2)18-26-13-15-27(16-14-26)23-11-10-21(28-7)17-22(23)25(6)12-8-9-20(3)24(25,4)5;/h10-11,17,19-20H,8-9,12-16,18H2,1-7H3;1H |
| InChIKey | IXUIGSAHXDARLU-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.09 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|