C7H13NO3 — CID 45086724
(3S,5R)-5-(hydroxymethyl)-3,5-dimethylmorpholin-2-one (PubChem CID 45086724) has the molecular formula C7H13NO3 and a molecular weight of 159.18 g/mol. Its IUPAC name is (3S,5R)-5-(hydroxymethyl)-3,5-dimethylmorpholin-2-one.
| Compound Name | (3S,5R)-5-(hydroxymethyl)-3,5-dimethylmorpholin-2-one |
|---|---|
| PubChem CID | 45086724 |
| Molecular Formula | C7H13NO3 |
| Molecular Weight | 159.18 g/mol |
| Exact Mass | 159.09 |
| IUPAC Name | (3S,5R)-5-(hydroxymethyl)-3,5-dimethylmorpholin-2-one |
| SMILES | C[C@@H]1N[C@](C)(CO)COC1=O |
| InChI | InChI=1S/C7H13NO3/c1-5-6(10)11-4-7(2,3-9)8-5/h5,8-9H,3-4H2,1-2H3/t5-,7+/m0/s1 |
| InChIKey | LJAQOUYVXODSQO-CAHLUQPWSA-N |
| XLogP | -0.73 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.18 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |