C8H18N2O2 — CID 143466094
ethane;(4-methyl-2-methylimino-1,3-oxazolidin-4-yl)methanol (PubChem CID 143466094) has the molecular formula C8H18N2O2 and a molecular weight of 174.24 g/mol. Its IUPAC name is ethane;(4-methyl-2-methylimino-1,3-oxazolidin-4-yl)methanol.
| Compound Name | ethane;(4-methyl-2-methylimino-1,3-oxazolidin-4-yl)methanol |
|---|---|
| PubChem CID | 143466094 |
| Molecular Formula | C8H18N2O2 |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.14 |
| IUPAC Name | ethane;(4-methyl-2-methylimino-1,3-oxazolidin-4-yl)methanol |
| SMILES | C/N=C1/NC(C)(CO)CO1.CC |
| InChI | InChI=1S/C6H12N2O2.C2H6/c1-6(3-9)4-10-5(7-2)8-6;1-2/h9H,3-4H2,1-2H3,(H,7,8);1-2H3 |
| InChIKey | DKXMICCWADULTG-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|