C7H16ClNO2 — CID 170911656
(3-methyl-1,4-oxazepan-3-yl)methanol;hydrochloride (PubChem CID 170911656) has the molecular formula C7H16ClNO2 and a molecular weight of 181.66 g/mol. Its IUPAC name is (3-methyl-1,4-oxazepan-3-yl)methanol;hydrochloride.
| Compound Name | (3-methyl-1,4-oxazepan-3-yl)methanol;hydrochloride |
|---|---|
| PubChem CID | 170911656 |
| Molecular Formula | C7H16ClNO2 |
| Molecular Weight | 181.66 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | (3-methyl-1,4-oxazepan-3-yl)methanol;hydrochloride |
| SMILES | CC1(CO)COCCCN1.Cl |
| InChI | InChI=1S/C7H15NO2.ClH/c1-7(5-9)6-10-4-2-3-8-7;/h8-9H,2-6H2,1H3;1H |
| InChIKey | JCZOSNQLTVFXMN-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.66 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |