C12H17NO3 — CID 105480408
3-[3-(hydroxymethyl)-1,4-oxazepan-3-yl]phenol (PubChem CID 105480408) has the molecular formula C12H17NO3 and a molecular weight of 223.27 g/mol. Its IUPAC name is 3-[3-(hydroxymethyl)-1,4-oxazepan-3-yl]phenol.
| Compound Name | 3-[3-(hydroxymethyl)-1,4-oxazepan-3-yl]phenol |
|---|---|
| PubChem CID | 105480408 |
| Molecular Formula | C12H17NO3 |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | 3-[3-(hydroxymethyl)-1,4-oxazepan-3-yl]phenol |
| SMILES | OCC1(c2cccc(O)c2)COCCCN1 |
| InChI | InChI=1S/C12H17NO3/c14-8-12(9-16-6-2-5-13-12)10-3-1-4-11(15)7-10/h1,3-4,7,13-15H,2,5-6,8-9H2 |
| InChIKey | VNYUXKYZVIMNPW-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |