C12H16FNO2 — CID 105482953
[3-(4-fluorophenyl)-1,4-oxazepan-3-yl]methanol (PubChem CID 105482953) has the molecular formula C12H16FNO2 and a molecular weight of 225.26 g/mol. Its IUPAC name is [3-(4-fluorophenyl)-1,4-oxazepan-3-yl]methanol.
| Compound Name | [3-(4-fluorophenyl)-1,4-oxazepan-3-yl]methanol |
|---|---|
| PubChem CID | 105482953 |
| Molecular Formula | C12H16FNO2 |
| Molecular Weight | 225.26 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | [3-(4-fluorophenyl)-1,4-oxazepan-3-yl]methanol |
| SMILES | OCC1(c2ccc(F)cc2)COCCCN1 |
| InChI | InChI=1S/C12H16FNO2/c13-11-4-2-10(3-5-11)12(8-15)9-16-7-1-6-14-12/h2-5,14-15H,1,6-9H2 |
| InChIKey | ATMQTXLMLZENCE-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.26 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |