About 3-tert-butyl-1,4-oxazepane-3-carboxylic acid
3-tert-butyl-1,4-oxazepane-3-carboxylic acid (PubChem CID 105453564) has the molecular formula C10H19NO3
and a molecular weight of 201.27 g/mol. Its IUPAC name is 3-tert-butyl-1,4-oxazepane-3-carboxylic acid.
Molecular Properties
| Compound Name | 3-tert-butyl-1,4-oxazepane-3-carboxylic acid |
| PubChem CID | 105453564 |
| Molecular Formula | C10H19NO3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.14 |
| IUPAC Name | 3-tert-butyl-1,4-oxazepane-3-carboxylic acid |
| SMILES | CC(C)(C)C1(C(=O)O)COCCCN1 |
| InChI | InChI=1S/C10H19NO3/c1-9(2,3)10(8(12)13)7-14-6-4-5-11-10/h11H,4-7H2,1-3H3,(H,12,13) |
| InChIKey | SEYNTAVCTHRSAI-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-tert-butyl-1,4-oxazepane-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-tert-butyl-1,4-oxazepane-3-carboxylic acid?
The IUPAC name of 3-tert-butyl-1,4-oxazepane-3-carboxylic acid (CID 105453564) is 3-tert-butyl-1,4-oxazepane-3-carboxylic acid.
What is the SMILES notation for 3-tert-butyl-1,4-oxazepane-3-carboxylic acid?
The canonical SMILES for 3-tert-butyl-1,4-oxazepane-3-carboxylic acid is CC(C)(C)C1(C(=O)O)COCCCN1.
What is the InChIKey of 3-tert-butyl-1,4-oxazepane-3-carboxylic acid?
The InChIKey is SEYNTAVCTHRSAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19NO3/c1-9(2,3)10(8(12)13)7-14-6-4-5-11-10/h11H,4-7H2,1-3H3,(H,12,13).
What are the key properties of 3-tert-butyl-1,4-oxazepane-3-carboxylic acid?
3-tert-butyl-1,4-oxazepane-3-carboxylic acid has a molecular weight of 201.27 g/mol, XLogP of 0.87, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-tert-butyl-1,4-oxazepane-3-carboxylic acid is sourced from PubChem (CID 105453564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).