methyl 3-(cyclopropylmethyl)-1,4-oxazepane-3-carboxylate

C11H19NO3 — CID 105466761

IUPACmethyl 3-(cyclopropylmethyl)-1,4-oxazepane-3-carboxylate
SMILESCOC(=O)C1(CC2CC2)COCCCN1
InChIInChI=1S/C11H19NO3/c1-14-10(13)11(7-9-3-4-9)8-15-6-2-5-12-11/h9,12H,2-8H2,1H3
InChIKeyKOZHPEHFKXAVHM-UHFFFAOYSA-N
MW213.28 g/mol
LogP0.71
Rot. Bonds3

About methyl 3-(cyclopropylmethyl)-1,4-oxazepane-3-carboxylate

methyl 3-(cyclopropylmethyl)-1,4-oxazepane-3-carboxylate (PubChem CID 105466761) has the molecular formula C11H19NO3 and a molecular weight of 213.28 g/mol. Its IUPAC name is methyl 3-(cyclopropylmethyl)-1,4-oxazepane-3-carboxylate.

Molecular Properties

Compound Namemethyl 3-(cyclopropylmethyl)-1,4-oxazepane-3-carboxylate
PubChem CID105466761
Molecular FormulaC11H19NO3
Molecular Weight213.28 g/mol
Exact Mass213.14
IUPAC Namemethyl 3-(cyclopropylmethyl)-1,4-oxazepane-3-carboxylate
SMILESCOC(=O)C1(CC2CC2)COCCCN1
InChIInChI=1S/C11H19NO3/c1-14-10(13)11(7-9-3-4-9)8-15-6-2-5-12-11/h9,12H,2-8H2,1H3
InChIKeyKOZHPEHFKXAVHM-UHFFFAOYSA-N
XLogP0.71
TPSA47.56 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500213.28
LogP ≤ 50.71
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze methyl 3-(cyclopropylmethyl)-1,4-oxazepane-3-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-(cyclopropylmethyl)-1,4-oxazepane-3-carboxylate?
The IUPAC name of methyl 3-(cyclopropylmethyl)-1,4-oxazepane-3-carboxylate (CID 105466761) is methyl 3-(cyclopropylmethyl)-1,4-oxazepane-3-carboxylate.
What is the SMILES notation for methyl 3-(cyclopropylmethyl)-1,4-oxazepane-3-carboxylate?
The canonical SMILES for methyl 3-(cyclopropylmethyl)-1,4-oxazepane-3-carboxylate is COC(=O)C1(CC2CC2)COCCCN1.
What is the InChIKey of methyl 3-(cyclopropylmethyl)-1,4-oxazepane-3-carboxylate?
The InChIKey is KOZHPEHFKXAVHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19NO3/c1-14-10(13)11(7-9-3-4-9)8-15-6-2-5-12-11/h9,12H,2-8H2,1H3.
What are the key properties of methyl 3-(cyclopropylmethyl)-1,4-oxazepane-3-carboxylate?
methyl 3-(cyclopropylmethyl)-1,4-oxazepane-3-carboxylate has a molecular weight of 213.28 g/mol, XLogP of 0.71, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(cyclopropylmethyl)-1,4-oxazepane-3-carboxylate is sourced from PubChem (CID 105466761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).