About 3-cyclopentyl-1,4-oxazepane-3-carboxylic acid
3-cyclopentyl-1,4-oxazepane-3-carboxylic acid (PubChem CID 105466758) has the molecular formula C11H19NO3
and a molecular weight of 213.28 g/mol. Its IUPAC name is 3-cyclopentyl-1,4-oxazepane-3-carboxylic acid.
Molecular Properties
| Compound Name | 3-cyclopentyl-1,4-oxazepane-3-carboxylic acid |
| PubChem CID | 105466758 |
| Molecular Formula | C11H19NO3 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.14 |
| IUPAC Name | 3-cyclopentyl-1,4-oxazepane-3-carboxylic acid |
| SMILES | O=C(O)C1(C2CCCC2)COCCCN1 |
| InChI | InChI=1S/C11H19NO3/c13-10(14)11(9-4-1-2-5-9)8-15-7-3-6-12-11/h9,12H,1-8H2,(H,13,14) |
| InChIKey | QYSMIQPRRGXZGP-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-cyclopentyl-1,4-oxazepane-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclopentyl-1,4-oxazepane-3-carboxylic acid?
The IUPAC name of 3-cyclopentyl-1,4-oxazepane-3-carboxylic acid (CID 105466758) is 3-cyclopentyl-1,4-oxazepane-3-carboxylic acid.
What is the SMILES notation for 3-cyclopentyl-1,4-oxazepane-3-carboxylic acid?
The canonical SMILES for 3-cyclopentyl-1,4-oxazepane-3-carboxylic acid is O=C(O)C1(C2CCCC2)COCCCN1.
What is the InChIKey of 3-cyclopentyl-1,4-oxazepane-3-carboxylic acid?
The InChIKey is QYSMIQPRRGXZGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19NO3/c13-10(14)11(9-4-1-2-5-9)8-15-7-3-6-12-11/h9,12H,1-8H2,(H,13,14).
What are the key properties of 3-cyclopentyl-1,4-oxazepane-3-carboxylic acid?
3-cyclopentyl-1,4-oxazepane-3-carboxylic acid has a molecular weight of 213.28 g/mol, XLogP of 1.01, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclopentyl-1,4-oxazepane-3-carboxylic acid is sourced from PubChem (CID 105466758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).