3-cyclopentyl-1,4-oxazepane-3-carboxylic acid

C11H19NO3 — CID 105466758

IUPAC3-cyclopentyl-1,4-oxazepane-3-carboxylic acid
SMILESO=C(O)C1(C2CCCC2)COCCCN1
InChIInChI=1S/C11H19NO3/c13-10(14)11(9-4-1-2-5-9)8-15-7-3-6-12-11/h9,12H,1-8H2,(H,13,14)
InChIKeyQYSMIQPRRGXZGP-UHFFFAOYSA-N
MW213.28 g/mol
LogP1.01
Rot. Bonds2

About 3-cyclopentyl-1,4-oxazepane-3-carboxylic acid

3-cyclopentyl-1,4-oxazepane-3-carboxylic acid (PubChem CID 105466758) has the molecular formula C11H19NO3 and a molecular weight of 213.28 g/mol. Its IUPAC name is 3-cyclopentyl-1,4-oxazepane-3-carboxylic acid.

Molecular Properties

Compound Name3-cyclopentyl-1,4-oxazepane-3-carboxylic acid
PubChem CID105466758
Molecular FormulaC11H19NO3
Molecular Weight213.28 g/mol
Exact Mass213.14
IUPAC Name3-cyclopentyl-1,4-oxazepane-3-carboxylic acid
SMILESO=C(O)C1(C2CCCC2)COCCCN1
InChIInChI=1S/C11H19NO3/c13-10(14)11(9-4-1-2-5-9)8-15-7-3-6-12-11/h9,12H,1-8H2,(H,13,14)
InChIKeyQYSMIQPRRGXZGP-UHFFFAOYSA-N
XLogP1.01
TPSA58.56 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500213.28
LogP ≤ 51.01
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 3-cyclopentyl-1,4-oxazepane-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-cyclopentyl-1,4-oxazepane-3-carboxylic acid?
The IUPAC name of 3-cyclopentyl-1,4-oxazepane-3-carboxylic acid (CID 105466758) is 3-cyclopentyl-1,4-oxazepane-3-carboxylic acid.
What is the SMILES notation for 3-cyclopentyl-1,4-oxazepane-3-carboxylic acid?
The canonical SMILES for 3-cyclopentyl-1,4-oxazepane-3-carboxylic acid is O=C(O)C1(C2CCCC2)COCCCN1.
What is the InChIKey of 3-cyclopentyl-1,4-oxazepane-3-carboxylic acid?
The InChIKey is QYSMIQPRRGXZGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19NO3/c13-10(14)11(9-4-1-2-5-9)8-15-7-3-6-12-11/h9,12H,1-8H2,(H,13,14).
What are the key properties of 3-cyclopentyl-1,4-oxazepane-3-carboxylic acid?
3-cyclopentyl-1,4-oxazepane-3-carboxylic acid has a molecular weight of 213.28 g/mol, XLogP of 1.01, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclopentyl-1,4-oxazepane-3-carboxylic acid is sourced from PubChem (CID 105466758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).