3-propyl-1,4-oxazepane-3-carboxylic acid

C9H17NO3 — CID 105442568

IUPAC3-propyl-1,4-oxazepane-3-carboxylic acid
SMILESCCCC1(C(=O)O)COCCCN1
InChIInChI=1S/C9H17NO3/c1-2-4-9(8(11)12)7-13-6-3-5-10-9/h10H,2-7H2,1H3,(H,11,12)
InChIKeySJSAYTARTGPLGU-UHFFFAOYSA-N
MW187.24 g/mol
LogP0.62
Rot. Bonds3

About 3-propyl-1,4-oxazepane-3-carboxylic acid

3-propyl-1,4-oxazepane-3-carboxylic acid (PubChem CID 105442568) has the molecular formula C9H17NO3 and a molecular weight of 187.24 g/mol. Its IUPAC name is 3-propyl-1,4-oxazepane-3-carboxylic acid.

Molecular Properties

Compound Name3-propyl-1,4-oxazepane-3-carboxylic acid
PubChem CID105442568
Molecular FormulaC9H17NO3
Molecular Weight187.24 g/mol
Exact Mass187.12
IUPAC Name3-propyl-1,4-oxazepane-3-carboxylic acid
SMILESCCCC1(C(=O)O)COCCCN1
InChIInChI=1S/C9H17NO3/c1-2-4-9(8(11)12)7-13-6-3-5-10-9/h10H,2-7H2,1H3,(H,11,12)
InChIKeySJSAYTARTGPLGU-UHFFFAOYSA-N
XLogP0.62
TPSA58.56 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500187.24
LogP ≤ 50.62
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 3-propyl-1,4-oxazepane-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-propyl-1,4-oxazepane-3-carboxylic acid?
The IUPAC name of 3-propyl-1,4-oxazepane-3-carboxylic acid (CID 105442568) is 3-propyl-1,4-oxazepane-3-carboxylic acid.
What is the SMILES notation for 3-propyl-1,4-oxazepane-3-carboxylic acid?
The canonical SMILES for 3-propyl-1,4-oxazepane-3-carboxylic acid is CCCC1(C(=O)O)COCCCN1.
What is the InChIKey of 3-propyl-1,4-oxazepane-3-carboxylic acid?
The InChIKey is SJSAYTARTGPLGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO3/c1-2-4-9(8(11)12)7-13-6-3-5-10-9/h10H,2-7H2,1H3,(H,11,12).
What are the key properties of 3-propyl-1,4-oxazepane-3-carboxylic acid?
3-propyl-1,4-oxazepane-3-carboxylic acid has a molecular weight of 187.24 g/mol, XLogP of 0.62, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-propyl-1,4-oxazepane-3-carboxylic acid is sourced from PubChem (CID 105442568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).