C10H12FNO — CID 117193573
(6-fluoro-2-methyl-1,3-dihydroindol-2-yl)methanol (PubChem CID 117193573) has the molecular formula C10H12FNO and a molecular weight of 181.21 g/mol. Its IUPAC name is (6-fluoro-2-methyl-1,3-dihydroindol-2-yl)methanol.
| Compound Name | (6-fluoro-2-methyl-1,3-dihydroindol-2-yl)methanol |
|---|---|
| PubChem CID | 117193573 |
| Molecular Formula | C10H12FNO |
| Molecular Weight | 181.21 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | (6-fluoro-2-methyl-1,3-dihydroindol-2-yl)methanol |
| SMILES | CC1(CO)Cc2ccc(F)cc2N1 |
| InChI | InChI=1S/C10H12FNO/c1-10(6-13)5-7-2-3-8(11)4-9(7)12-10/h2-4,12-13H,5-6H2,1H3 |
| InChIKey | XWEIJMRLPSBDLL-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.21 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |