C17H15F2N — CID 24966129
4,13-difluoro-9-methyl-17-azatetracyclo[7.6.2.02,7.010,15]heptadeca-2(7),3,5,10(15),11,13-hexaene (PubChem CID 24966129) has the molecular formula C17H15F2N and a molecular weight of 271.31 g/mol. Its IUPAC name is 4,13-difluoro-9-methyl-17-azatetracyclo[7.6.2.02,7.010,15]heptadeca-2(7),3,5,10(15),11,13-hexaene.
| Compound Name | 4,13-difluoro-9-methyl-17-azatetracyclo[7.6.2.02,7.010,15]heptadeca-2(7),3,5,10(15),11,13-hexaene |
|---|---|
| PubChem CID | 24966129 |
| Molecular Formula | C17H15F2N |
| Molecular Weight | 271.31 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | 4,13-difluoro-9-methyl-17-azatetracyclo[7.6.2.02,7.010,15]heptadeca-2(7),3,5,10(15),11,13-hexaene |
| SMILES | CC12Cc3ccc(F)cc3C(CN1)c1cc(F)ccc12 |
| InChI | InChI=1S/C17H15F2N/c1-17-8-10-2-3-11(18)6-13(10)15(9-20-17)14-7-12(19)4-5-16(14)17/h2-7,15,20H,8-9H2,1H3 |
| InChIKey | DAVMYGCLSYJFLA-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.31 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |