C12H15N — CID 102526165
2-methyl-2-prop-2-enyl-1,3-dihydroindole (PubChem CID 102526165) has the molecular formula C12H15N and a molecular weight of 173.26 g/mol. Its IUPAC name is 2-methyl-2-prop-2-enyl-1,3-dihydroindole.
| Compound Name | 2-methyl-2-prop-2-enyl-1,3-dihydroindole |
|---|---|
| PubChem CID | 102526165 |
| Molecular Formula | C12H15N |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | 2-methyl-2-prop-2-enyl-1,3-dihydroindole |
| SMILES | C=CCC1(C)Cc2ccccc2N1 |
| InChI | InChI=1S/C12H15N/c1-3-8-12(2)9-10-6-4-5-7-11(10)13-12/h3-7,13H,1,8-9H2,2H3 |
| InChIKey | OOSKRNMVFCKMDU-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|