C13H18N2 — CID 170208528
1'-methylspiro[1,3-dihydroindole-2,4'-piperidine] (PubChem CID 170208528) has the molecular formula C13H18N2 and a molecular weight of 202.30 g/mol. Its IUPAC name is 1'-methylspiro[1,3-dihydroindole-2,4'-piperidine].
| Compound Name | 1'-methylspiro[1,3-dihydroindole-2,4'-piperidine] |
|---|---|
| PubChem CID | 170208528 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | 1'-methylspiro[1,3-dihydroindole-2,4'-piperidine] |
| SMILES | CN1CCC2(CC1)Cc1ccccc1N2 |
| InChI | InChI=1S/C13H18N2/c1-15-8-6-13(7-9-15)10-11-4-2-3-5-12(11)14-13/h2-5,14H,6-10H2,1H3 |
| InChIKey | IACFGHFNZZWFPQ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |