About 1'-methylspiro[1,3-dihydroindole-2,4'-piperidine]
1'-methylspiro[1,3-dihydroindole-2,4'-piperidine] (PubChem CID 170208528) has the molecular formula C13H18N2
and a molecular weight of 202.30 g/mol. Its IUPAC name is 1'-methylspiro[1,3-dihydroindole-2,4'-piperidine].
Molecular Properties
| Compound Name | 1'-methylspiro[1,3-dihydroindole-2,4'-piperidine] |
| PubChem CID | 170208528 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | 1'-methylspiro[1,3-dihydroindole-2,4'-piperidine] |
| SMILES | CN1CCC2(CC1)Cc1ccccc1N2 |
| InChI | InChI=1S/C13H18N2/c1-15-8-6-13(7-9-15)10-11-4-2-3-5-12(11)14-13/h2-5,14H,6-10H2,1H3 |
| InChIKey | IACFGHFNZZWFPQ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1'-methylspiro[1,3-dihydroindole-2,4'-piperidine] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1'-methylspiro[1,3-dihydroindole-2,4'-piperidine]?
The IUPAC name of 1'-methylspiro[1,3-dihydroindole-2,4'-piperidine] (CID 170208528) is 1'-methylspiro[1,3-dihydroindole-2,4'-piperidine].
What is the SMILES notation for 1'-methylspiro[1,3-dihydroindole-2,4'-piperidine]?
The canonical SMILES for 1'-methylspiro[1,3-dihydroindole-2,4'-piperidine] is CN1CCC2(CC1)Cc1ccccc1N2.
What is the InChIKey of 1'-methylspiro[1,3-dihydroindole-2,4'-piperidine]?
The InChIKey is IACFGHFNZZWFPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N2/c1-15-8-6-13(7-9-15)10-11-4-2-3-5-12(11)14-13/h2-5,14H,6-10H2,1H3.
What are the key properties of 1'-methylspiro[1,3-dihydroindole-2,4'-piperidine]?
1'-methylspiro[1,3-dihydroindole-2,4'-piperidine] has a molecular weight of 202.30 g/mol, XLogP of 2.12, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1'-methylspiro[1,3-dihydroindole-2,4'-piperidine] is sourced from PubChem (CID 170208528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).