C9H9NO3 — CID 155488692
(2S)-spiro[1,3-dihydroindole-2,3'-oxirane]-2',2'-diol (PubChem CID 155488692) has the molecular formula C9H9NO3 and a molecular weight of 179.18 g/mol. Its IUPAC name is (2S)-spiro[1,3-dihydroindole-2,3'-oxirane]-2',2'-diol.
| Compound Name | (2S)-spiro[1,3-dihydroindole-2,3'-oxirane]-2',2'-diol |
|---|---|
| PubChem CID | 155488692 |
| Molecular Formula | C9H9NO3 |
| Molecular Weight | 179.18 g/mol |
| Exact Mass | 179.06 |
| IUPAC Name | (2S)-spiro[1,3-dihydroindole-2,3'-oxirane]-2',2'-diol |
| SMILES | OC1(O)O[C@@]12Cc1ccccc1N2 |
| InChI | InChI=1S/C9H9NO3/c11-9(12)8(13-9)5-6-3-1-2-4-7(6)10-8/h1-4,10-12H,5H2/t8-/m0/s1 |
| InChIKey | IDIMHWSRGSJGMT-QMMMGPOBSA-N |
| XLogP | 0.02 |
| TPSA | 65.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.18 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|