C16H14O3 — CID 51028831
(1S,9R)-17-oxatetracyclo[7.7.1.02,7.010,15]heptadeca-2,4,6,10,12,14-hexaene-1,9-diol (PubChem CID 51028831) has the molecular formula C16H14O3 and a molecular weight of 254.29 g/mol. Its IUPAC name is (1S,9R)-17-oxatetracyclo[7.7.1.02,7.010,15]heptadeca-2,4,6,10,12,14-hexaene-1,9-diol.
| Compound Name | (1S,9R)-17-oxatetracyclo[7.7.1.02,7.010,15]heptadeca-2,4,6,10,12,14-hexaene-1,9-diol |
|---|---|
| PubChem CID | 51028831 |
| Molecular Formula | C16H14O3 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | (1S,9R)-17-oxatetracyclo[7.7.1.02,7.010,15]heptadeca-2,4,6,10,12,14-hexaene-1,9-diol |
| SMILES | O[C@@]12Cc3ccccc3[C@](O)(Cc3ccccc31)O2 |
| InChI | InChI=1S/C16H14O3/c17-15-9-11-5-1-3-7-13(11)16(18,19-15)10-12-6-2-4-8-14(12)15/h1-8,17-18H,9-10H2/t15-,16+ |
| InChIKey | RMYUTJTUIHOVJM-IYBDPMFKSA-N |
| XLogP | 1.81 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |