About spiro[bicyclo[4.2.0]octa-1,3,5-triene-7,3'-diazirine]
spiro[bicyclo[4.2.0]octa-1,3,5-triene-7,3'-diazirine] (PubChem CID 10749210) has the molecular formula C8H6N2
and a molecular weight of 130.15 g/mol. Its IUPAC name is spiro[bicyclo[4.2.0]octa-1,3,5-triene-7,3'-diazirine].
Analyze spiro[bicyclo[4.2.0]octa-1,3,5-triene-7,3'-diazirine] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[bicyclo[4.2.0]octa-1,3,5-triene-7,3'-diazirine]?
The IUPAC name of spiro[bicyclo[4.2.0]octa-1,3,5-triene-7,3'-diazirine] (CID 10749210) is spiro[bicyclo[4.2.0]octa-1,3,5-triene-7,3'-diazirine].
What is the SMILES notation for spiro[bicyclo[4.2.0]octa-1,3,5-triene-7,3'-diazirine]?
The canonical SMILES for spiro[bicyclo[4.2.0]octa-1,3,5-triene-7,3'-diazirine] is c1ccc2c(c1)CC21N=N1.
What is the InChIKey of spiro[bicyclo[4.2.0]octa-1,3,5-triene-7,3'-diazirine]?
The InChIKey is UBTQVRCWWOJNHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2/c1-2-4-7-6(3-1)5-8(7)9-10-8/h1-4H,5H2.
What are the key properties of spiro[bicyclo[4.2.0]octa-1,3,5-triene-7,3'-diazirine]?
spiro[bicyclo[4.2.0]octa-1,3,5-triene-7,3'-diazirine] has a molecular weight of 130.15 g/mol, XLogP of 1.86, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[bicyclo[4.2.0]octa-1,3,5-triene-7,3'-diazirine] is sourced from PubChem (CID 10749210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).