C13H10CrO5+6 — CID 11986145
carbon monoxide;chromium(6+);spiro[1,3-dioxolane-2,7'-bicyclo[4.2.0]octa-1,3,5-triene] (PubChem CID 11986145) has the molecular formula C13H10CrO5+6 and a molecular weight of 298.21 g/mol. Its IUPAC name is carbon monoxide;chromium(6+);spiro[1,3-dioxolane-2,7'-bicyclo[4.2.0]octa-1,3,5-triene].
| Compound Name | carbon monoxide;chromium(6+);spiro[1,3-dioxolane-2,7'-bicyclo[4.2.0]octa-1,3,5-triene] |
|---|---|
| PubChem CID | 11986145 |
| Molecular Formula | C13H10CrO5+6 |
| Molecular Weight | 298.21 g/mol |
| Exact Mass | 297.99 |
| IUPAC Name | carbon monoxide;chromium(6+);spiro[1,3-dioxolane-2,7'-bicyclo[4.2.0]octa-1,3,5-triene] |
| SMILES | [C-]#[O+].[C-]#[O+].[C-]#[O+].[Cr+6].c1ccc2c(c1)CC21OCCO1 |
| InChI | InChI=1S/C10H10O2.3CO.Cr/c1-2-4-9-8(3-1)7-10(9)11-5-6-12-10;3*1-2;/h1-4H,5-7H2;;;;/q;;;;+6 |
| InChIKey | XRZIUGYNTBWWTD-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 78.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.21 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|