About spiro[1,3-dioxolane-2,4'-2,3-dihydro-1H-isoquinoline]
spiro[1,3-dioxolane-2,4'-2,3-dihydro-1H-isoquinoline] (PubChem CID 20703604) has the molecular formula C11H13NO2
and a molecular weight of 191.23 g/mol. Its IUPAC name is spiro[1,3-dioxolane-2,4'-2,3-dihydro-1H-isoquinoline].
Analyze spiro[1,3-dioxolane-2,4'-2,3-dihydro-1H-isoquinoline] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[1,3-dioxolane-2,4'-2,3-dihydro-1H-isoquinoline]?
The IUPAC name of spiro[1,3-dioxolane-2,4'-2,3-dihydro-1H-isoquinoline] (CID 20703604) is spiro[1,3-dioxolane-2,4'-2,3-dihydro-1H-isoquinoline].
What is the SMILES notation for spiro[1,3-dioxolane-2,4'-2,3-dihydro-1H-isoquinoline]?
The canonical SMILES for spiro[1,3-dioxolane-2,4'-2,3-dihydro-1H-isoquinoline] is c1ccc2c(c1)CNCC21OCCO1.
What is the InChIKey of spiro[1,3-dioxolane-2,4'-2,3-dihydro-1H-isoquinoline]?
The InChIKey is IDFRYODJKVCXHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO2/c1-2-4-10-9(3-1)7-12-8-11(10)13-5-6-14-11/h1-4,12H,5-8H2.
What are the key properties of spiro[1,3-dioxolane-2,4'-2,3-dihydro-1H-isoquinoline]?
spiro[1,3-dioxolane-2,4'-2,3-dihydro-1H-isoquinoline] has a molecular weight of 191.23 g/mol, XLogP of 0.99, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[1,3-dioxolane-2,4'-2,3-dihydro-1H-isoquinoline] is sourced from PubChem (CID 20703604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).