C11H9IO2 — CID 138965819
3'-iodospiro[1,3-dioxolane-2,1'-indene] (PubChem CID 138965819) has the molecular formula C11H9IO2 and a molecular weight of 300.09 g/mol. Its IUPAC name is 3'-iodospiro[1,3-dioxolane-2,1'-indene].
| Compound Name | 3'-iodospiro[1,3-dioxolane-2,1'-indene] |
|---|---|
| PubChem CID | 138965819 |
| Molecular Formula | C11H9IO2 |
| Molecular Weight | 300.09 g/mol |
| Exact Mass | 299.96 |
| IUPAC Name | 3'-iodospiro[1,3-dioxolane-2,1'-indene] |
| SMILES | IC1=CC2(OCCO2)c2ccccc21 |
| InChI | InChI=1S/C11H9IO2/c12-10-7-11(13-5-6-14-11)9-4-2-1-3-8(9)10/h1-4,7H,5-6H2 |
| InChIKey | AOIGUZBIEAWXGO-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.09 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|