C15H16O3 — CID 11630125
5,5-dimethylspiro[1,3-dioxane-2,4'-naphthalene]-1'-one (PubChem CID 11630125) has the molecular formula C15H16O3 and a molecular weight of 244.29 g/mol. Its IUPAC name is 5,5-dimethylspiro[1,3-dioxane-2,4'-naphthalene]-1'-one.
| Compound Name | 5,5-dimethylspiro[1,3-dioxane-2,4'-naphthalene]-1'-one |
|---|---|
| PubChem CID | 11630125 |
| Molecular Formula | C15H16O3 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | 5,5-dimethylspiro[1,3-dioxane-2,4'-naphthalene]-1'-one |
| SMILES | CC1(C)COC2(C=CC(=O)c3ccccc32)OC1 |
| InChI | InChI=1S/C15H16O3/c1-14(2)9-17-15(18-10-14)8-7-13(16)11-5-3-4-6-12(11)15/h3-8H,9-10H2,1-2H3 |
| InChIKey | NFOIWELBLOKWIK-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |