C16H10O3 — CID 102432288
(1R)-1-methyl-10-oxatetracyclo[7.6.1.02,7.012,16]hexadeca-2,4,6,9(16),11,14-hexaene-8,13-dione (PubChem CID 102432288) has the molecular formula C16H10O3 and a molecular weight of 250.25 g/mol. Its IUPAC name is (1R)-1-methyl-10-oxatetracyclo[7.6.1.02,7.012,16]hexadeca-2,4,6,9(16),11,14-hexaene-8,13-dione.
| Compound Name | (1R)-1-methyl-10-oxatetracyclo[7.6.1.02,7.012,16]hexadeca-2,4,6,9(16),11,14-hexaene-8,13-dione |
|---|---|
| PubChem CID | 102432288 |
| Molecular Formula | C16H10O3 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | (1R)-1-methyl-10-oxatetracyclo[7.6.1.02,7.012,16]hexadeca-2,4,6,9(16),11,14-hexaene-8,13-dione |
| SMILES | C[C@]12C=CC(=O)c3coc(c31)C(=O)c1ccccc12 |
| InChI | InChI=1S/C16H10O3/c1-16-7-6-12(17)10-8-19-15(13(10)16)14(18)9-4-2-3-5-11(9)16/h2-8H,1H3/t16-/m1/s1 |
| InChIKey | UDOPYBITCVPEJX-MRXNPFEDSA-N |
| XLogP | 2.88 |
| TPSA | 47.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |