C15H14O4 — CID 162952223
(4S)-4-hydroperoxy-3,4,5-trimethylbenzo[f][1]benzofuran-9-one (PubChem CID 162952223) has the molecular formula C15H14O4 and a molecular weight of 258.27 g/mol. Its IUPAC name is (4S)-4-hydroperoxy-3,4,5-trimethylbenzo[f][1]benzofuran-9-one.
| Compound Name | (4S)-4-hydroperoxy-3,4,5-trimethylbenzo[f][1]benzofuran-9-one |
|---|---|
| PubChem CID | 162952223 |
| Molecular Formula | C15H14O4 |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | (4S)-4-hydroperoxy-3,4,5-trimethylbenzo[f][1]benzofuran-9-one |
| SMILES | Cc1cccc2c1[C@](C)(OO)c1c(C)coc1C2=O |
| InChI | InChI=1S/C15H14O4/c1-8-5-4-6-10-11(8)15(3,19-17)12-9(2)7-18-14(12)13(10)16/h4-7,17H,1-3H3/t15-/m0/s1 |
| InChIKey | WJJDWAGMRXHMKI-HNNXBMFYSA-N |
| XLogP | 3.19 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.27 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|