C14H8O4 — CID 86149483
5-methyl-4,9-dioxobenzo[f][1]benzofuran-3-carbaldehyde (PubChem CID 86149483) has the molecular formula C14H8O4 and a molecular weight of 240.21 g/mol. Its IUPAC name is 5-methyl-4,9-dioxobenzo[f][1]benzofuran-3-carbaldehyde.
| Compound Name | 5-methyl-4,9-dioxobenzo[f][1]benzofuran-3-carbaldehyde |
|---|---|
| PubChem CID | 86149483 |
| Molecular Formula | C14H8O4 |
| Molecular Weight | 240.21 g/mol |
| Exact Mass | 240.04 |
| IUPAC Name | 5-methyl-4,9-dioxobenzo[f][1]benzofuran-3-carbaldehyde |
| SMILES | Cc1cccc2c1C(=O)c1c(C=O)coc1C2=O |
| InChI | InChI=1S/C14H8O4/c1-7-3-2-4-9-10(7)13(17)11-8(5-15)6-18-14(11)12(9)16/h2-6H,1H3 |
| InChIKey | YCIKNVGKQDOMAG-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 64.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.21 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|