C17H14O5 — CID 102066919
ethyl 3,5-dimethyl-4,9-dioxobenzo[f][1]benzofuran-2-carboxylate (PubChem CID 102066919) has the molecular formula C17H14O5 and a molecular weight of 298.29 g/mol. Its IUPAC name is ethyl 3,5-dimethyl-4,9-dioxobenzo[f][1]benzofuran-2-carboxylate.
| Compound Name | ethyl 3,5-dimethyl-4,9-dioxobenzo[f][1]benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 102066919 |
| Molecular Formula | C17H14O5 |
| Molecular Weight | 298.29 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | ethyl 3,5-dimethyl-4,9-dioxobenzo[f][1]benzofuran-2-carboxylate |
| SMILES | CCOC(=O)c1oc2c(c1C)C(=O)c1c(C)cccc1C2=O |
| InChI | InChI=1S/C17H14O5/c1-4-21-17(20)15-9(3)12-14(19)11-8(2)6-5-7-10(11)13(18)16(12)22-15/h5-7H,4H2,1-3H3 |
| InChIKey | WEXCYRVYLIOBJT-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 73.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.29 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|