C13H14N2O3 — CID 66008471
ethyl 5-amino-2-(2-methylphenyl)-1,3-oxazole-4-carboxylate (PubChem CID 66008471) has the molecular formula C13H14N2O3 and a molecular weight of 246.27 g/mol. Its IUPAC name is ethyl 5-amino-2-(2-methylphenyl)-1,3-oxazole-4-carboxylate.
| Compound Name | ethyl 5-amino-2-(2-methylphenyl)-1,3-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 66008471 |
| Molecular Formula | C13H14N2O3 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | ethyl 5-amino-2-(2-methylphenyl)-1,3-oxazole-4-carboxylate |
| SMILES | CCOC(=O)c1nc(-c2ccccc2C)oc1N |
| InChI | InChI=1S/C13H14N2O3/c1-3-17-13(16)10-11(14)18-12(15-10)9-7-5-4-6-8(9)2/h4-7H,3,14H2,1-2H3 |
| InChIKey | QMMKQMJLULYFJY-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |