C14H14O5 — CID 95240377
[(3S)-3-hydroperoxy-2,3-dimethyl-4-oxonaphthalen-1-yl] acetate (PubChem CID 95240377) has the molecular formula C14H14O5 and a molecular weight of 262.26 g/mol. Its IUPAC name is [(3S)-3-hydroperoxy-2,3-dimethyl-4-oxonaphthalen-1-yl] acetate.
| Compound Name | [(3S)-3-hydroperoxy-2,3-dimethyl-4-oxonaphthalen-1-yl] acetate |
|---|---|
| PubChem CID | 95240377 |
| Molecular Formula | C14H14O5 |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | [(3S)-3-hydroperoxy-2,3-dimethyl-4-oxonaphthalen-1-yl] acetate |
| SMILES | CC(=O)OC1=C(C)[C@](C)(OO)C(=O)c2ccccc21 |
| InChI | InChI=1S/C14H14O5/c1-8-12(18-9(2)15)10-6-4-5-7-11(10)13(16)14(8,3)19-17/h4-7,17H,1-3H3/t14-/m0/s1 |
| InChIKey | XRMQFJFXRVWWHK-AWEZNQCLSA-N |
| XLogP | 2.43 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|