C13H13NO3 — CID 141385097
1-hydroxy-4,4-dimethyl-3-oxonaphthalene-2-carboxamide (PubChem CID 141385097) has the molecular formula C13H13NO3 and a molecular weight of 231.25 g/mol. Its IUPAC name is 1-hydroxy-4,4-dimethyl-3-oxonaphthalene-2-carboxamide.
| Compound Name | 1-hydroxy-4,4-dimethyl-3-oxonaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 141385097 |
| Molecular Formula | C13H13NO3 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | 1-hydroxy-4,4-dimethyl-3-oxonaphthalene-2-carboxamide |
| SMILES | CC1(C)C(=O)C(C(N)=O)=C(O)c2ccccc21 |
| InChI | InChI=1S/C13H13NO3/c1-13(2)8-6-4-3-5-7(8)10(15)9(11(13)16)12(14)17/h3-6,15H,1-2H3,(H2,14,17) |
| InChIKey | CLONGAJLQUIZPT-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|