C16H16O4 — CID 15258350
[(2aS,8aR)-2,2-dimethyl-3,8-dioxo-1,8a-dihydrocyclobuta[b]naphthalen-2a-yl] acetate (PubChem CID 15258350) has the molecular formula C16H16O4 and a molecular weight of 272.30 g/mol. Its IUPAC name is [(2aS,8aR)-2,2-dimethyl-3,8-dioxo-1,8a-dihydrocyclobuta[b]naphthalen-2a-yl] acetate.
| Compound Name | [(2aS,8aR)-2,2-dimethyl-3,8-dioxo-1,8a-dihydrocyclobuta[b]naphthalen-2a-yl] acetate |
|---|---|
| PubChem CID | 15258350 |
| Molecular Formula | C16H16O4 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | [(2aS,8aR)-2,2-dimethyl-3,8-dioxo-1,8a-dihydrocyclobuta[b]naphthalen-2a-yl] acetate |
| SMILES | CC(=O)O[C@@]12C(=O)c3ccccc3C(=O)[C@@H]1CC2(C)C |
| InChI | InChI=1S/C16H16O4/c1-9(17)20-16-12(8-15(16,2)3)13(18)10-6-4-5-7-11(10)14(16)19/h4-7,12H,8H2,1-3H3/t12-,16+/m0/s1 |
| InChIKey | AECIEYOJWDYNJL-BLLLJJGKSA-N |
| XLogP | 2.41 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'} |
|---|