C16H14O2 — CID 102019366
3-ethenyl-4,4-dimethylbenzo[f][1]benzofuran-9-one (PubChem CID 102019366) has the molecular formula C16H14O2 and a molecular weight of 238.29 g/mol. Its IUPAC name is 3-ethenyl-4,4-dimethylbenzo[f][1]benzofuran-9-one.
| Compound Name | 3-ethenyl-4,4-dimethylbenzo[f][1]benzofuran-9-one |
|---|---|
| PubChem CID | 102019366 |
| Molecular Formula | C16H14O2 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | 3-ethenyl-4,4-dimethylbenzo[f][1]benzofuran-9-one |
| SMILES | C=Cc1coc2c1C(C)(C)c1ccccc1C2=O |
| InChI | InChI=1S/C16H14O2/c1-4-10-9-18-15-13(10)16(2,3)12-8-6-5-7-11(12)14(15)17/h4-9H,1H2,2-3H3 |
| InChIKey | FQPVKSIDMHTACW-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |