About 9,9-dimethyl-1-phenylfluorene;methane
9,9-dimethyl-1-phenylfluorene;methane (PubChem CID 142541097) has the molecular formula C24H30
and a molecular weight of 318.50 g/mol. Its IUPAC name is 9,9-dimethyl-1-phenylfluorene;methane.
Molecular Properties
| Compound Name | 9,9-dimethyl-1-phenylfluorene;methane |
| PubChem CID | 142541097 |
| Molecular Formula | C24H30 |
| Molecular Weight | 318.50 g/mol |
| Exact Mass | 318.23 |
| IUPAC Name | 9,9-dimethyl-1-phenylfluorene;methane |
| SMILES | C.C.C.CC1(C)c2ccccc2-c2cccc(-c3ccccc3)c21 |
| InChI | InChI=1S/C21H18.3CH4/c1-21(2)19-14-7-6-11-17(19)18-13-8-12-16(20(18)21)15-9-4-3-5-10-15;;;/h3-14H,1-2H3;3*1H4 |
| InChIKey | GINUKMVAKSVZHA-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 318.50 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 9,9-dimethyl-1-phenylfluorene;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9,9-dimethyl-1-phenylfluorene;methane?
The IUPAC name of 9,9-dimethyl-1-phenylfluorene;methane (CID 142541097) is 9,9-dimethyl-1-phenylfluorene;methane.
What is the SMILES notation for 9,9-dimethyl-1-phenylfluorene;methane?
The canonical SMILES for 9,9-dimethyl-1-phenylfluorene;methane is C.C.C.CC1(C)c2ccccc2-c2cccc(-c3ccccc3)c21.
What is the InChIKey of 9,9-dimethyl-1-phenylfluorene;methane?
The InChIKey is GINUKMVAKSVZHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18.3CH4/c1-21(2)19-14-7-6-11-17(19)18-13-8-12-16(20(18)21)15-9-4-3-5-10-15;;;/h3-14H,1-2H3;3*1H4.
What are the key properties of 9,9-dimethyl-1-phenylfluorene;methane?
9,9-dimethyl-1-phenylfluorene;methane has a molecular weight of 318.50 g/mol, XLogP of 7.57, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 9,9-dimethyl-1-phenylfluorene;methane is sourced from PubChem (CID 142541097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).