C11H12FNO2 — CID 117193321
2-ethyl-5-fluoro-1,3-dihydroindole-2-carboxylic acid (PubChem CID 117193321) has the molecular formula C11H12FNO2 and a molecular weight of 209.22 g/mol. Its IUPAC name is 2-ethyl-5-fluoro-1,3-dihydroindole-2-carboxylic acid.
| Compound Name | 2-ethyl-5-fluoro-1,3-dihydroindole-2-carboxylic acid |
|---|---|
| PubChem CID | 117193321 |
| Molecular Formula | C11H12FNO2 |
| Molecular Weight | 209.22 g/mol |
| Exact Mass | 209.09 |
| IUPAC Name | 2-ethyl-5-fluoro-1,3-dihydroindole-2-carboxylic acid |
| SMILES | CCC1(C(=O)O)Cc2cc(F)ccc2N1 |
| InChI | InChI=1S/C11H12FNO2/c1-2-11(10(14)15)6-7-5-8(12)3-4-9(7)13-11/h3-5,13H,2,6H2,1H3,(H,14,15) |
| InChIKey | NAIZCCGXBBVDBI-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.22 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |