C12H15FN2 — CID 105459074
6-fluorospiro[1,3-dihydroindole-2,4'-piperidine] (PubChem CID 105459074) has the molecular formula C12H15FN2 and a molecular weight of 206.26 g/mol. Its IUPAC name is 6-fluorospiro[1,3-dihydroindole-2,4'-piperidine].
| Compound Name | 6-fluorospiro[1,3-dihydroindole-2,4'-piperidine] |
|---|---|
| PubChem CID | 105459074 |
| Molecular Formula | C12H15FN2 |
| Molecular Weight | 206.26 g/mol |
| Exact Mass | 206.12 |
| IUPAC Name | 6-fluorospiro[1,3-dihydroindole-2,4'-piperidine] |
| SMILES | Fc1ccc2c(c1)NC1(CCNCC1)C2 |
| InChI | InChI=1S/C12H15FN2/c13-10-2-1-9-8-12(15-11(9)7-10)3-5-14-6-4-12/h1-2,7,14-15H,3-6,8H2 |
| InChIKey | UQCWSTPYCOKCDS-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.26 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |