C14H16FN — CID 58295805
CID 58295805 (PubChem CID 58295805) has the molecular formula C14H16FN and a molecular weight of 217.29 g/mol.
| Compound Name | CID 58295805 |
|---|---|
| PubChem CID | 58295805 |
| Molecular Formula | C14H16FN |
| Molecular Weight | 217.29 g/mol |
| Exact Mass | 217.13 |
| IUPAC Name | — |
| SMILES | [CH]C1CC2(CCNCC2)c2cc(F)ccc21 |
| InChI | InChI=1S/C14H16FN/c1-10-9-14(4-6-16-7-5-14)13-8-11(15)2-3-12(10)13/h1-3,8,10,16H,4-7,9H2 |
| InChIKey | JRZUVQLIKZIFCO-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.29 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |