C13H14FNO — CID 175058607
6-fluorospiro[3H-indene-2,4'-piperidine]-1-one (PubChem CID 175058607) has the molecular formula C13H14FNO and a molecular weight of 219.26 g/mol. Its IUPAC name is 6-fluorospiro[3H-indene-2,4'-piperidine]-1-one.
| Compound Name | 6-fluorospiro[3H-indene-2,4'-piperidine]-1-one |
|---|---|
| PubChem CID | 175058607 |
| Molecular Formula | C13H14FNO |
| Molecular Weight | 219.26 g/mol |
| Exact Mass | 219.11 |
| IUPAC Name | 6-fluorospiro[3H-indene-2,4'-piperidine]-1-one |
| SMILES | O=C1c2cc(F)ccc2CC12CCNCC2 |
| InChI | InChI=1S/C13H14FNO/c14-10-2-1-9-8-13(3-5-15-6-4-13)12(16)11(9)7-10/h1-2,7,15H,3-6,8H2 |
| InChIKey | OTZOXSWOUUQVQG-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.26 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |