C11H9FO2 — CID 82277921
6-fluorospiro[2H-chromene-3,1'-cyclopropane]-4-one (PubChem CID 82277921) has the molecular formula C11H9FO2 and a molecular weight of 192.19 g/mol. Its IUPAC name is 6-fluorospiro[2H-chromene-3,1'-cyclopropane]-4-one.
| Compound Name | 6-fluorospiro[2H-chromene-3,1'-cyclopropane]-4-one |
|---|---|
| PubChem CID | 82277921 |
| Molecular Formula | C11H9FO2 |
| Molecular Weight | 192.19 g/mol |
| Exact Mass | 192.06 |
| IUPAC Name | 6-fluorospiro[2H-chromene-3,1'-cyclopropane]-4-one |
| SMILES | O=C1c2cc(F)ccc2OCC12CC2 |
| InChI | InChI=1S/C11H9FO2/c12-7-1-2-9-8(5-7)10(13)11(3-4-11)6-14-9/h1-2,5H,3-4,6H2 |
| InChIKey | SOJLLCANIIHBIO-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.19 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |