C11H12FNO — CID 130901339
5-fluorospiro[2H-1-benzofuran-3,3'-pyrrolidine] (PubChem CID 130901339) has the molecular formula C11H12FNO and a molecular weight of 193.22 g/mol. Its IUPAC name is 5-fluorospiro[2H-1-benzofuran-3,3'-pyrrolidine].
| Compound Name | 5-fluorospiro[2H-1-benzofuran-3,3'-pyrrolidine] |
|---|---|
| PubChem CID | 130901339 |
| Molecular Formula | C11H12FNO |
| Molecular Weight | 193.22 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | 5-fluorospiro[2H-1-benzofuran-3,3'-pyrrolidine] |
| SMILES | Fc1ccc2c(c1)C1(CCNC1)CO2 |
| InChI | InChI=1S/C11H12FNO/c12-8-1-2-10-9(5-8)11(7-14-10)3-4-13-6-11/h1-2,5,13H,3-4,6-7H2 |
| InChIKey | ASZFYCDTYZUAJP-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.22 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |