C12H14FNO2 — CID 117045993
6-fluorospiro[3H-1,4-benzodioxine-2,3'-piperidine] (PubChem CID 117045993) has the molecular formula C12H14FNO2 and a molecular weight of 223.25 g/mol. Its IUPAC name is 6-fluorospiro[3H-1,4-benzodioxine-2,3'-piperidine].
| Compound Name | 6-fluorospiro[3H-1,4-benzodioxine-2,3'-piperidine] |
|---|---|
| PubChem CID | 117045993 |
| Molecular Formula | C12H14FNO2 |
| Molecular Weight | 223.25 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | 6-fluorospiro[3H-1,4-benzodioxine-2,3'-piperidine] |
| SMILES | Fc1ccc2c(c1)OCC1(CCCNC1)O2 |
| InChI | InChI=1S/C12H14FNO2/c13-9-2-3-10-11(6-9)15-8-12(16-10)4-1-5-14-7-12/h2-3,6,14H,1,4-5,7-8H2 |
| InChIKey | DUIXASBLXBLDNB-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.25 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |