C11H12F3N — CID 71239192
4-(2,4-difluorophenyl)-4-fluoropiperidine (PubChem CID 71239192) has the molecular formula C11H12F3N and a molecular weight of 215.22 g/mol. Its IUPAC name is 4-(2,4-difluorophenyl)-4-fluoropiperidine.
| Compound Name | 4-(2,4-difluorophenyl)-4-fluoropiperidine |
|---|---|
| PubChem CID | 71239192 |
| Molecular Formula | C11H12F3N |
| Molecular Weight | 215.22 g/mol |
| Exact Mass | 215.09 |
| IUPAC Name | 4-(2,4-difluorophenyl)-4-fluoropiperidine |
| SMILES | Fc1ccc(C2(F)CCNCC2)c(F)c1 |
| InChI | InChI=1S/C11H12F3N/c12-8-1-2-9(10(13)7-8)11(14)3-5-15-6-4-11/h1-2,7,15H,3-6H2 |
| InChIKey | BBKRCGFNYPJHQV-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.22 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |