C6H10O5 — CID 11137448
3-hydroxy-4,4-bis(hydroxymethyl)oxolan-2-one (PubChem CID 11137448) has the molecular formula C6H10O5 and a molecular weight of 162.14 g/mol. Its IUPAC name is 3-hydroxy-4,4-bis(hydroxymethyl)oxolan-2-one.
| Compound Name | 3-hydroxy-4,4-bis(hydroxymethyl)oxolan-2-one |
|---|---|
| PubChem CID | 11137448 |
| Molecular Formula | C6H10O5 |
| Molecular Weight | 162.14 g/mol |
| Exact Mass | 162.05 |
| IUPAC Name | 3-hydroxy-4,4-bis(hydroxymethyl)oxolan-2-one |
| SMILES | O=C1OCC(CO)(CO)C1O |
| InChI | InChI=1S/C6H10O5/c7-1-6(2-8)3-11-5(10)4(6)9/h4,7-9H,1-3H2 |
| InChIKey | OTKQVLPFAFOYAJ-UHFFFAOYSA-N |
| XLogP | -2.12 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.14 |
| LogP ≤ 5 | -2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |