C15H22O7 — CID 11174466
(1S,2R,4R,5R,6R,10R,13R)-4,5,10,13-tetrahydroxy-2,6,13-trimethyl-8-oxatricyclo[4.4.3.01,5]tridecane-9,12-dione (PubChem CID 11174466) has the molecular formula C15H22O7 and a molecular weight of 314.33 g/mol. Its IUPAC name is (1S,2R,4R,5R,6R,10R,13R)-4,5,10,13-tetrahydroxy-2,6,13-trimethyl-8-oxatricyclo[4.4.3.01,5]tridecane-9,12-dione.
| Compound Name | (1S,2R,4R,5R,6R,10R,13R)-4,5,10,13-tetrahydroxy-2,6,13-trimethyl-8-oxatricyclo[4.4.3.01,5]tridecane-9,12-dione |
|---|---|
| PubChem CID | 11174466 |
| Molecular Formula | C15H22O7 |
| Molecular Weight | 314.33 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | (1S,2R,4R,5R,6R,10R,13R)-4,5,10,13-tetrahydroxy-2,6,13-trimethyl-8-oxatricyclo[4.4.3.01,5]tridecane-9,12-dione |
| SMILES | C[C@@H]1C[C@@H](O)[C@@]2(O)[C@@]13CC(=O)[C@](C)(O)[C@]2(C)COC(=O)[C@@H]3O |
| InChI | InChI=1S/C15H22O7/c1-7-4-8(16)15(21)12(2)6-22-11(19)10(18)14(7,15)5-9(17)13(12,3)20/h7-8,10,16,18,20-21H,4-6H2,1-3H3/t7-,8-,10+,12+,13+,14+,15+/m1/s1 |
| InChIKey | ZEUNGNSKSPFREL-SOCMYRBGSA-N |
| XLogP | -1.25 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.33 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |