C15H18O7 — CID 44542226
(1S,2R,4S,6R,9R,10R,14S,15R)-10,15-dihydroxy-2,14-dimethyl-5,8,12-trioxapentacyclo[7.6.1.01,6.04,15.010,14]hexadecane-7,11-dione (PubChem CID 44542226) has the molecular formula C15H18O7 and a molecular weight of 310.30 g/mol. Its IUPAC name is (1S,2R,4S,6R,9R,10R,14S,15R)-10,15-dihydroxy-2,14-dimethyl-5,8,12-trioxapentacyclo[7.6.1.01,6.04,15.010,14]hexadecane-7,11-dione.
| Compound Name | (1S,2R,4S,6R,9R,10R,14S,15R)-10,15-dihydroxy-2,14-dimethyl-5,8,12-trioxapentacyclo[7.6.1.01,6.04,15.010,14]hexadecane-7,11-dione |
|---|---|
| PubChem CID | 44542226 |
| Molecular Formula | C15H18O7 |
| Molecular Weight | 310.30 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | (1S,2R,4S,6R,9R,10R,14S,15R)-10,15-dihydroxy-2,14-dimethyl-5,8,12-trioxapentacyclo[7.6.1.01,6.04,15.010,14]hexadecane-7,11-dione |
| SMILES | C[C@@H]1C[C@@H]2O[C@H]3C(=O)O[C@@H]4C[C@]13[C@@]2(O)[C@]1(C)COC(=O)[C@]41O |
| InChI | InChI=1S/C15H18O7/c1-6-3-7-15(19)12(2)5-20-11(17)14(12,18)8-4-13(6,15)9(21-7)10(16)22-8/h6-9,18-19H,3-5H2,1-2H3/t6-,7+,8-,9+,12-,13+,14-,15+/m1/s1 |
| InChIKey | KXYYBBVKQOHNOP-QTWYHDFGSA-N |
| XLogP | -0.87 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.30 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |