C16H20O10 — CID 25243169
methyl (1S,2S,3S,5R,6R,7R,8R,11R)-3,5,7,11-tetrahydroxy-2-methyl-2',10-dioxospiro[9-oxatricyclo[6.3.1.01,5]dodecane-6,3'-oxetane]-7-carboxylate (PubChem CID 25243169) has the molecular formula C16H20O10 and a molecular weight of 372.33 g/mol. Its IUPAC name is methyl (1S,2S,3S,5R,6R,7R,8R,11R)-3,5,7,11-tetrahydroxy-2-methyl-2',10-dioxospiro[9-oxatricyclo[6.3.1.01,5]dodecane-6,3'-oxetane]-7-carboxylate.
| Compound Name | methyl (1S,2S,3S,5R,6R,7R,8R,11R)-3,5,7,11-tetrahydroxy-2-methyl-2',10-dioxospiro[9-oxatricyclo[6.3.1.01,5]dodecane-6,3'-oxetane]-7-carboxylate |
|---|---|
| PubChem CID | 25243169 |
| Molecular Formula | C16H20O10 |
| Molecular Weight | 372.33 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | methyl (1S,2S,3S,5R,6R,7R,8R,11R)-3,5,7,11-tetrahydroxy-2-methyl-2',10-dioxospiro[9-oxatricyclo[6.3.1.01,5]dodecane-6,3'-oxetane]-7-carboxylate |
| SMILES | COC(=O)[C@]1(O)[C@H]2C[C@]3([C@H](C)[C@@H](O)C[C@]3(O)[C@]13COC3=O)[C@@H](O)C(=O)O2 |
| InChI | InChI=1S/C16H20O10/c1-6-7(17)3-15(22)13(6)4-8(26-10(19)9(13)18)16(23,12(21)24-2)14(15)5-25-11(14)20/h6-9,17-18,22-23H,3-5H2,1-2H3/t6-,7+,8-,9+,13+,14-,15-,16-/m1/s1 |
| InChIKey | KKTVZPCHFKMXRN-FOFYPWIUSA-N |
| XLogP | -2.76 |
| TPSA | 159.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.33 |
| LogP ≤ 5 | -2.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'four_member_lactones', 'substructure': 'N/A'} |
|---|