C15H20O5 — CID 101155566
(1R,2R,5S,6R,7S,8R,11R)-11-hydroxy-2,7-dimethylspiro[9-oxatricyclo[6.3.1.01,5]dodecane-6,3'-oxetane]-2',10-dione (PubChem CID 101155566) has the molecular formula C15H20O5 and a molecular weight of 280.32 g/mol. Its IUPAC name is (1R,2R,5S,6R,7S,8R,11R)-11-hydroxy-2,7-dimethylspiro[9-oxatricyclo[6.3.1.01,5]dodecane-6,3'-oxetane]-2',10-dione.
| Compound Name | (1R,2R,5S,6R,7S,8R,11R)-11-hydroxy-2,7-dimethylspiro[9-oxatricyclo[6.3.1.01,5]dodecane-6,3'-oxetane]-2',10-dione |
|---|---|
| PubChem CID | 101155566 |
| Molecular Formula | C15H20O5 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | (1R,2R,5S,6R,7S,8R,11R)-11-hydroxy-2,7-dimethylspiro[9-oxatricyclo[6.3.1.01,5]dodecane-6,3'-oxetane]-2',10-dione |
| SMILES | C[C@@H]1[C@H]2C[C@]3([C@H](C)CC[C@@H]3[C@]13COC3=O)[C@@H](O)C(=O)O2 |
| InChI | InChI=1S/C15H20O5/c1-7-3-4-10-14(7)5-9(20-12(17)11(14)16)8(2)15(10)6-19-13(15)18/h7-11,16H,3-6H2,1-2H3/t7-,8-,9-,10+,11+,14-,15+/m1/s1 |
| InChIKey | LGACPORQYBHNCY-SIOQAHKGSA-N |
| XLogP | 0.89 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'four_member_lactones', 'substructure': 'N/A'} |
|---|