C20H32O8 — CID 78210162
[(1S,2R,5R,6S,7S,8S,11S)-5,7,11-trihydroxy-7-(methoxymethyl)-2,6-dimethyl-10-oxo-9-oxatricyclo[6.3.1.01,5]dodecan-6-yl]methyl butanoate (PubChem CID 78210162) has the molecular formula C20H32O8 and a molecular weight of 400.47 g/mol. Its IUPAC name is [(1S,2R,5R,6S,7S,8S,11S)-5,7,11-trihydroxy-7-(methoxymethyl)-2,6-dimethyl-10-oxo-9-oxatricyclo[6.3.1.01,5]dodecan-6-yl]methyl butanoate.
| Compound Name | [(1S,2R,5R,6S,7S,8S,11S)-5,7,11-trihydroxy-7-(methoxymethyl)-2,6-dimethyl-10-oxo-9-oxatricyclo[6.3.1.01,5]dodecan-6-yl]methyl butanoate |
|---|---|
| PubChem CID | 78210162 |
| Molecular Formula | C20H32O8 |
| Molecular Weight | 400.47 g/mol |
| Exact Mass | 400.21 |
| IUPAC Name | [(1S,2R,5R,6S,7S,8S,11S)-5,7,11-trihydroxy-7-(methoxymethyl)-2,6-dimethyl-10-oxo-9-oxatricyclo[6.3.1.01,5]dodecan-6-yl]methyl butanoate |
| SMILES | CCCC(=O)OC[C@@]1(C)[C@@]2(O)CC[C@@H](C)[C@]23C[C@H](OC(=O)[C@H]3O)[C@@]1(O)COC |
| InChI | InChI=1S/C20H32O8/c1-5-6-14(21)27-10-17(3)19(24,11-26-4)13-9-18(15(22)16(23)28-13)12(2)7-8-20(17,18)25/h12-13,15,22,24-25H,5-11H2,1-4H3/t12-,13+,15-,17-,18+,19+,20+/m1/s1 |
| InChIKey | KSDVZOGEAKMTIG-LVSCKUMJSA-N |
| XLogP | 0.55 |
| TPSA | 122.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.47 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |