C15H20O5 — CID 100918150
(1R,2S,3S,6R,7S,9S,12R)-3,6,7-trimethyl-11-oxo-10,13-dioxatetracyclo[7.4.0.01,12.03,7]tridecane-2-carboxylic acid (PubChem CID 100918150) has the molecular formula C15H20O5 and a molecular weight of 280.32 g/mol. Its IUPAC name is (1R,2S,3S,6R,7S,9S,12R)-3,6,7-trimethyl-11-oxo-10,13-dioxatetracyclo[7.4.0.01,12.03,7]tridecane-2-carboxylic acid.
| Compound Name | (1R,2S,3S,6R,7S,9S,12R)-3,6,7-trimethyl-11-oxo-10,13-dioxatetracyclo[7.4.0.01,12.03,7]tridecane-2-carboxylic acid |
|---|---|
| PubChem CID | 100918150 |
| Molecular Formula | C15H20O5 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | (1R,2S,3S,6R,7S,9S,12R)-3,6,7-trimethyl-11-oxo-10,13-dioxatetracyclo[7.4.0.01,12.03,7]tridecane-2-carboxylic acid |
| SMILES | C[C@@H]1CC[C@@]2(C)[C@H](C(=O)O)[C@]34O[C@H]3C(=O)O[C@H]4C[C@@]12C |
| InChI | InChI=1S/C15H20O5/c1-7-4-5-13(2)9(11(16)17)15-8(6-14(7,13)3)19-12(18)10(15)20-15/h7-10H,4-6H2,1-3H3,(H,16,17)/t7-,8+,9+,10+,13+,14+,15+/m1/s1 |
| InChIKey | DESLQMNLYDSEHD-BIHVFYQESA-N |
| XLogP | 1.60 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|