C13H22O — CID 12037157
(1R,2S,3aS,4R,6aS)-1,3a,4,6a-tetramethyl-1,2,3,4,5,6-hexahydropentalene-2-carbaldehyde (PubChem CID 12037157) has the molecular formula C13H22O and a molecular weight of 194.32 g/mol. Its IUPAC name is (1R,2S,3aS,4R,6aS)-1,3a,4,6a-tetramethyl-1,2,3,4,5,6-hexahydropentalene-2-carbaldehyde.
| Compound Name | (1R,2S,3aS,4R,6aS)-1,3a,4,6a-tetramethyl-1,2,3,4,5,6-hexahydropentalene-2-carbaldehyde |
|---|---|
| PubChem CID | 12037157 |
| Molecular Formula | C13H22O |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.17 |
| IUPAC Name | (1R,2S,3aS,4R,6aS)-1,3a,4,6a-tetramethyl-1,2,3,4,5,6-hexahydropentalene-2-carbaldehyde |
| SMILES | C[C@@H]1CC[C@@]2(C)[C@H](C)[C@@H](C=O)C[C@@]12C |
| InChI | InChI=1S/C13H22O/c1-9-5-6-12(3)10(2)11(8-14)7-13(9,12)4/h8-11H,5-7H2,1-4H3/t9-,10-,11-,12+,13+/m1/s1 |
| InChIKey | JXCGPUXDVXPEJM-KVSVUVNWSA-N |
| XLogP | 3.28 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|