C22H32O5 — CID 88713801
(2S,7S,10S,11S,13S,14R,15S)-14-hydroxy-14-(2-hydroxyacetyl)-2,13,15-trimethyl-18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadecan-5-one (PubChem CID 88713801) has the molecular formula C22H32O5 and a molecular weight of 376.49 g/mol. Its IUPAC name is (2S,7S,10S,11S,13S,14R,15S)-14-hydroxy-14-(2-hydroxyacetyl)-2,13,15-trimethyl-18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadecan-5-one.
| Compound Name | (2S,7S,10S,11S,13S,14R,15S)-14-hydroxy-14-(2-hydroxyacetyl)-2,13,15-trimethyl-18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadecan-5-one |
|---|---|
| PubChem CID | 88713801 |
| Molecular Formula | C22H32O5 |
| Molecular Weight | 376.49 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | (2S,7S,10S,11S,13S,14R,15S)-14-hydroxy-14-(2-hydroxyacetyl)-2,13,15-trimethyl-18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadecan-5-one |
| SMILES | C[C@H]1C[C@H]2C3CC[C@H]4CC(=O)CC[C@]4(C)C34OC4C[C@]2(C)[C@@]1(O)C(=O)CO |
| InChI | InChI=1S/C22H32O5/c1-12-8-16-15-5-4-13-9-14(24)6-7-19(13,2)22(15)18(27-22)10-20(16,3)21(12,26)17(25)11-23/h12-13,15-16,18,23,26H,4-11H2,1-3H3/t12-,13-,15?,16-,18?,19-,20-,21-,22?/m0/s1 |
| InChIKey | XVWGIVIBBSBJJQ-FKFHOZNRSA-N |
| XLogP | 2.27 |
| TPSA | 87.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.49 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|