C22H27FO7 — CID 88746377
(1R,2S,10S,11S,14R,15S)-8-fluoro-14-hydroxy-14-(2-hydroxyacetyl)-2,13,15-trimethyl-18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadecane-3,5,6-trione (PubChem CID 88746377) has the molecular formula C22H27FO7 and a molecular weight of 422.45 g/mol. Its IUPAC name is (1R,2S,10S,11S,14R,15S)-8-fluoro-14-hydroxy-14-(2-hydroxyacetyl)-2,13,15-trimethyl-18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadecane-3,5,6-trione.
| Compound Name | (1R,2S,10S,11S,14R,15S)-8-fluoro-14-hydroxy-14-(2-hydroxyacetyl)-2,13,15-trimethyl-18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadecane-3,5,6-trione |
|---|---|
| PubChem CID | 88746377 |
| Molecular Formula | C22H27FO7 |
| Molecular Weight | 422.45 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | (1R,2S,10S,11S,14R,15S)-8-fluoro-14-hydroxy-14-(2-hydroxyacetyl)-2,13,15-trimethyl-18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadecane-3,5,6-trione |
| SMILES | CC1C[C@H]2[C@@H]3CC(F)C4C(=O)C(=O)CC(=O)[C@]4(C)[C@]34OC4C[C@]2(C)[C@@]1(O)C(=O)CO |
| InChI | InChI=1S/C22H27FO7/c1-9-4-10-11-5-12(23)17-18(28)13(25)6-14(26)20(17,3)22(11)16(30-22)7-19(10,2)21(9,29)15(27)8-24/h9-12,16-17,24,29H,4-8H2,1-3H3/t9?,10-,11-,12?,16?,17?,19-,20-,21-,22-/m0/s1 |
| InChIKey | HAHVUARYUKXCLY-YHXOBASOSA-N |
| XLogP | 0.57 |
| TPSA | 121.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.45 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|