C23H30O5 — CID 171034792
(1S,2S,14R,15S)-14-hydroxy-14-(2-hydroxyacetyl)-2,8,13,15-tetramethyl-18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadeca-3,6-dien-5-one (PubChem CID 171034792) has the molecular formula C23H30O5 and a molecular weight of 386.49 g/mol. Its IUPAC name is (1S,2S,14R,15S)-14-hydroxy-14-(2-hydroxyacetyl)-2,8,13,15-tetramethyl-18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadeca-3,6-dien-5-one.
| Compound Name | (1S,2S,14R,15S)-14-hydroxy-14-(2-hydroxyacetyl)-2,8,13,15-tetramethyl-18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadeca-3,6-dien-5-one |
|---|---|
| PubChem CID | 171034792 |
| Molecular Formula | C23H30O5 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | (1S,2S,14R,15S)-14-hydroxy-14-(2-hydroxyacetyl)-2,8,13,15-tetramethyl-18-oxapentacyclo[8.8.0.01,17.02,7.011,15]octadeca-3,6-dien-5-one |
| SMILES | CC1CC2C3CC(C)[C@](O)(C(=O)CO)[C@@]3(C)CC3O[C@@]32[C@@]2(C)C=CC(=O)C=C12 |
| InChI | InChI=1S/C23H30O5/c1-12-7-17-16-8-13(2)22(27,18(26)11-24)21(16,4)10-19-23(17,28-19)20(3)6-5-14(25)9-15(12)20/h5-6,9,12-13,16-17,19,24,27H,7-8,10-11H2,1-4H3/t12?,13?,16?,17?,19?,20-,21-,22-,23+/m0/s1 |
| InChIKey | HSBDSYMMTNYTJM-BIJPSHFLSA-N |
| XLogP | 2.21 |
| TPSA | 87.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|